Деловая сеть Хабаровск
Компании:7 116
Товары и услуги:6 720
Статьи и публикации:399
Тендеры и вакансии:62

Химические реактивы (химреактивы)

Химические реактивы (химреактивы)
Купить
+7 (4212) 68-07-63
Наличие в Хабаровске и под заказ! Отправка по РФ: ж/ д, авиа-курьер, почта, авто-.
Наименование Квалификация Хим.формула Цена, руб./кг
1-Бромнафталин ч C10H7Br по запросу
1,4-Диоксан чда * по запросу
1,5-Нафталиндисульфокислоты динатриевая соль ч * по запросу
2,4-Дихлоранилин, 99%
имп (Германия) * по запросу
2,4-Ксилидин ч (CH3)2C6H3NH2 по запросу
4-Аминоантипирин чда C11H13N3O по запросу
N-Цетилпиридиний хлористый 1-вод. ч C21H38ClN·H2O по запросу
N,N-Диметиланилин ч * по запросу
N,N-Дифенилгуанидин ч (C6H5NH)2C=NH по запросу
Агароза имп (Германия) * по запросу
Азотная кислота хч HNO3
по запросу
Азур 1 ч C14H14ClN3S по запросу
Азур-Эозин по Романовскому (сухой)
ч * по запросу
Азур-Эозин по Романовскому (раствор) ч * по запросу
Алюминий азотнокислый 9-вод. ч Al(NO3)3*9H2O по запросу
Алюминий оксид имп Al2O3 по запросу
Алюминий сернокислый 18-вод. хч Al2(SO4)3*18H2O по запросу
Алюминон ИМП (NH4OOCC6H3OH)2C=C6H3(O)COONH4 по запросу
Алюмоаммонийные квасцы ч NH4Al(SO4)2·12H2O по запросу
Алюмокалиевые квасцы чда KAI(SO4)2·12H2O
по запросу
Акриламид для электрофореза 2-кр. имп (Германия) C3H5NO по запросу
Аминоуксусная кислота ч * по запросу
Аммоний азотнокислый чда NH4NO3 по запросу
Аммоний ванадиевокислый мета ч NH4VO3 по запросу
Аммоний молибденовокислый 4-вод. чда (NH4)6Mo7O24·4H2O по запросу
Аммоний надсернокислый (персульфат) ч (NH4)2S2O8 по запросу
Аммоний роданистый имп NH4SCN по запросу
Аммоний сернокислый хч (NH4)2SO4 по запросу
Аммоний углекислый ч (NH4)2CO3 по запросу
Аммоний уксуснокислый чда CH3COONH4 по запросу
Аммоний фосфорнокислый 1-зам. ч * по запросу
Аммоний хлористый хч NH4Cl по запросу
Анилин гидрохлорид чда С6Н7N·HCl по запросу
Анионит Ав-17-8чс сорт 1 * по запросу
Аскарит ч * по запросу
Аскорбиновая кислота имп C6H8O6 по запросу
Атебрин дигидрохлорид 90%, Sigma, 25 гр имп * по запросу
Ацетальдегид 99% имп (Германия) * по запросу
Ацетонитрил, л
ч CH3CN по запросу
Ацетонитрил "Сорт 5", л осч по запросу
Ацетонитрил "Сорт 4", л осч по запросу
Ацетонитрил "Сорт 3", л осч по запросу
Ацетонитрил "Сорт 2", л осч по запросу
Ацетонитрил "Сорт 1", л осч по запросу
Ацетонитрил "Сорт 0", л осч по запросу
Барий гидроокись 6-вод. чда Ba(OH)2·6H2O по запросу
Барий гидроокись 8-вод. чда Ba(OH)2·8H2O по запросу
Барий сернокислый ч BaSO4 по запросу
Барий уксуснокислый чда (CH3COO)2Ba по запросу
Барий хлористый 2-вод. чда BaCl2·2H2O по запросу
Бензидин чда NH2C6H4C6H4NH2 по запросу
Бензидин дигидрохлорид (солянокислый) ЧДА NH2C6H4C6H4NH2*2HCl по запросу
Бензойная кислота ч C6H5COOH
по запросу
Бензол, л чда C6H6 по запросу
Борная кислота марка Б * по запросу
Бромная ртуть
чда HgBr2 по запросу
Бутанол-1 (спирт бутиловый нормальный) чда CH3(CH2)3OH по запросу
Бромистоводородная кислота ч * по запросу
Вазелиновое масло
фарм * по запросу
Винная кислота
чда C4H6O6 по запросу
Висмут азотнокислый основной (III)
ч BiONO3 по запросу
Висмут азотнокислый 5-водный чда * по запросу
Висмут сернокислый 3-водный ч * по запросу
Вольфрам (VI) оксид / III оксид
чда WO3
по запросу
Воск пчелиный * *   по запросу
Гексан для ТСХ 3 сорт, л
тсх CH3(CH2)4CH3
по запросу
Гексан ОСЧ "Сорт 3", л осч C6H14 по запросу
Гексан ХЧ "Сорт 2", л хч по запросу
Гексан ОСЧ "Сорт 1", л осч по запросу
Гексан ОСЧ "Сорт 1н", л осч по запросу
Гептан эталонный, л ГОСТ CH3(CH2)5CH3 по запросу
Гексадекан (цетан) эталон C16H34 по запросу
Гидразин дигидрохлорид (солянокислый)
чда NH2NH2·2HCl по запросу
Гидразин сернокислый чда NH2NH2*H2SO4 по запросу
Гидроксиламин гидрохлорид (солянокислый) * H3NO·HCl по запросу
Гидроксиламин сернокислый ч N2H6O2·H2SO4 по запросу
Гидрохинон
Сорт 1 C6H6O2 по запросу
Глицерин, фас. 26 кг
чда HOCH2CH(OH)CH2OH по запросу
Грисса реактив чда * по запросу
Дибутилсебацинат
ч CH3(CH2)3OOC(CH2)8COO(CH2)3CH3 по запросу
Диметилглиоксим чда CH3C(=NOH)C(=NOH)CH3 по запросу
Дифениламин чда * по запросу
Дифенилгуанидин-N,N ч (C6H5NH)2C=NH по запросу
Диметилсульфоксид ч (CH3)2SO по запросу
Диметилформамид хч * по запросу
Дибутилфталат (ДБФ) пластификатор * по запросу
Дифенилкарбазид чда C6H5NHNHCONHNHC6H5 по запросу
Диэтиламин, л * (C2H5)2NH по запросу
Диэтиламин гидрохлорид чда (C2H5)2NH·HCl по запросу
Диэтилоксалат ч C2H5OOCCOOC2H5 по запросу
Желатин, порошок имп (Германия) * по запросу
Железо (III) окись чда * по запросу
Железо (II) сернокислое 7-вод.
ч FeSO4·7H2O по запросу
Железо (III) хлорид 6-вод.
ч FeCl3·6H2O по запросу
Железоаммонийные квасцы
чда Fe(NH4)(SO4)2·12H2O по запросу
Изоамиловый спирт, л
чда C5H12O по запросу
Изобутиловый спирт, л чда (CH3)2CHCH2OH  по запросу
Изооктан эталонный, л ГОСТ (CH3)3CCH2CH(CH3)2 по запросу
Изопропиловый спирт, л хч (CH3)2CHOH по запросу
Индолилмасляная кислота (4-(Индолил-3)масляная кислота)
имп C12H13NO2 по запросу
Индулин жирорастворимый * * по запросу
Иттрий азотнокислый 6-вод. хч Y(NO3)3·6H2O по запросу
Йодистоводородная кислота чда * по запросу
Йодная кислота орто ч * по запросу
Кадмий сернокислый 8-вод. хч 3CdSO4·8H2O по запросу
Кадмий уксуснокислый (ацетат) чда Cd(CH3COO)2∙2H2O по запросу
Кадмий хлористый 2,5-вод. чда CdCl2·2,5H2O по запросу
Калий азотнокислый ч KNO3 по запросу
Калий азотистокислый ч * по запросу
Калий бромистый чда KBr по запросу
Калий бромноватокислый ч * по запросу
Калий гидроокись хч KOH по запросу
Калий двухромовокислый (хромпик)
чда K2Cr2O7 по запросу
Калий железистосинеродистый (желтая кровяная соль)
чда K4[Fe(CN)6]·3H2O  по запросу
Калий железосинеродистый (красная кровяная соль)
ч K3[Fe(CN)6] по запросу
Калий йодистый хч KI по запросу
Калий йодноватокислый (йодат) хч KIO3 по запросу
Калий йодноватокислый (йодат) чда по запросу
Калий йодноватокислый мета чда * по запросу
Калий йоднокислый мета чда KlO4 по запросу
Калий лимоннокислый 2-зам. чда HOOCC(OH)(CH2COOK)2 по запросу
Калий лимоннокислый 3-зам. чда C6H5K3O7·H2O по запросу
Калий надсернокислый чда K2S2O8 по запросу
Калий натрий-виннокислый чда С4Н4О6KNa·4H2O по запросу
Калий роданистый чда KSCN по запросу
Калий сернокислый чда K2SO4 по запросу
Калий сернокислый кислый ч * по запросу
Калий сернокислый пиро ч K2S2O7 по запросу
Калий сурьмяновиннокислый 0.5-вод
ч KOOCCH(OH)CH(OH)COOSbO*0.5H2O по запросу
Калий тетрафтороборат (борфтористый) чда KBF4 по запросу
Калий углекислый ХЧ K2CO3 по запросу
Калий углекислый кислый чда KHCO3 по запросу
Калий фосфорнокислый 1-зам. (дигидроортофофат)
ч КН2РО4 по запросу
Калий фосфорнокислый 1-зам. (дигидроортофофат) осч по запросу
Калий фосфорнокислый 98-100,5% Pharm grade
имп (Германия) по запросу
Калий фосфорнокислый 2-зам. 3-вод. ч K2HPO4·3H2O по запросу
Калий фталевокислый кислый (калий гидрофталат)
чда HOOCC6H4COOK по запросу
Калий фтористый 2-вод. чда KF·2H2O по запросу
Калий хлористый хч KCl по запросу
Калий хромовокислый хч K2CrO4 по запросу
Кальцеин динатриевая соль ипм C30H24N2Na2O13 по запросу
Кальций азотнокислый 4-вод. ч Ca(NO3)2*4H2O по запросу
Кальций гидроортофосфат для люминофоров ч * по запросу
Кальций дифосфат ч * по запросу
Кальций окись
ч CaO по запросу
Кальций ортофосфат ч Ca3(PO4)2 по запросу
Кальций углекислый имп CaCO3 по запросу
Кальций уксуснокислый 1-вод. ч (CH3COO)2Ca*H2O по запросу
Кальций фосфорнокислый 2-зам. 2-вод. ч CaHPO4*2H2O по запросу
Кальций хлористый б/в, гр.
имп CaCl2 по запросу
Кальций хлористый 6-вод. ч CaCl2·6H2O по запросу
Канадский бальзам, 1 л, 250 мл, 100 мл
имп (Германия) * по запросу
Кармин имп (США) С22Н20О13 по запросу
Касторовое масло
фарм * по запросу
Каучук синтетический бутадиен-нитрильный БНКС-28АМН * по запросу
Кобальт (III) оксид чда * по запросу
Кобальт (II, III) оксид чда * по запросу
Кобальт уксуснокислый (ацетат) ч * по запросу
Кобальт уксуснокислый 4-вод. ч * по запросу
Кобальт сернокислый 7-вод. чда CoSO4·7H2O по запросу
Кофеин имп (Германия) C8H10N4O2 по запросу
Крахмал растворимый чда (C6H10O5)n  по запросу
Криоспрей, 150 мл имп * по запросу
Лантан азотнокислый 6-вод. / Лантан нитрат, гексагидрат
ч La(NO3)3·6H2O по запросу
Лимонная кислота 1-вод. хч C6H8O7·H2O по запросу
Литий сернокислый 1-вод. (сульфат)
ч Li2SO4*H2O по запросу
Люмогалион чда (HO)2C6H3N=NC6H2(OH)(SO3H)Cl по запросу
Магний азотнокислый 6-вод. хч Mg(NO3)2·6H2O по запросу
Магний порошок * по запросу
Магний стружка * по запросу
Магний окись имп MgO по запросу
Магний сернокислый 7-вод. хч MgSO4·7H2O по запросу
Маннит фарм * по запросу
Марганец серноксилый (II) 1-вод.
имп
MnSO4*H2O
по запросу
Марганец хлористый (II) 4-вод. имп MnCl2·4H2O по запросу
Масло иммерсионное кедровое, 100 мл
имп (Германия) * по запросу
Масло иммерсионное нефлюоресцирующее, 100 мл имп (Германия) * по запросу
Масло минеральное легкое белое (парафиновое), 100 мл имп (Германия) * по запросу
Медь сернокислая 5-вод. (медный купорос) ч CuSO4·5H2O по запросу
Медь II окись проволока ч CuO по запросу
Медь, порошок ч Cu по запросу
Медь углекислая основная x * по запросу
Метилен хлористый хч CH2Cl2  по запросу
Метилен хлористый (для спектрометрии)
СП CH2Cl2 по запросу
Метилен хлористый (эталонный)
Э CH2Cl2 по запросу
Метилстирол-альфа 99%, л имп (Германия) * по запросу
Метол в/с C5H9NO по запросу
Монохлоруксусная кислота ч C2H3ClO2
по запросу
Мочевина чда NH2CONH2 по запросу
Муравьинная кислота имп HCOOH по запросу
Натрий азотистокислый чда NaNO2 по запросу
Натрий азотнокислый хч NaNO3  по запросу
Натрий вольфрамовокислый 2-вод.
чда Na2WO4·2H2O по запросу
Натрий гексанитрокобольтат (III), 0,5-вод.
чда Na3[Co(NO2)6]·0,5H2O по запросу
Натрий гидроокись чда NaOH по запросу
Натрий двухромовокислый хч Na2Cr2O7*2H2O по запросу
Натрий дитионит / натрий сернистокислый кислый / натрий гидросульфит
имп Na2S2O4
по запросу
Натрий диэтилдитиокарбамат, 3-вод. / натрий диэтилдитиокарбаминовокислый 3-вод. (купрал)
ч (C2H5)2NCSSNa·3H2O по запросу
Натрий йоднокислый мета / периодат имп NaIO4 по запросу
Натрий лимоннокислый 5,5-вод. (цитрат) ч Na3C6H5O7*5.5H2O по запросу
Натрий нитропруссид имп Na2[Fe(NO)(CN)5]*2H2O по запросу
Натрий молибденовокислый 2-вод. ЧДА Na2MoO4*2H2O по запросу
Натрий салициловокислый (салицилат) ч C7H5NaO3 по запросу
Натрий сернистокислый 7-вод. ч Na2SO3·7H2O по запросу
Натрий сернистый 9-вод. чда Na2S*9H2O по запросу
Натрий серноватистокислый (тиосульфат) 5-вод. чда Na2S2O3·5H2O по запросу
Натрий сернокислый б/в чда Na2SO4 по запросу
Натрий сернокислый 10-водный ч Na2SO4·10H2O по запросу
Натрий сернокислый 5-водный чда * по запросу
Натрий тетраборнокислый 10-вод. (бура)
хч Na2В4O7·10Н2О по запросу
Натрий углекислый б/в хч Na2CO3 по запросу
Натрий углекислый кислый чда NaHCO3 по запросу
Натрий уксуснокислый 3-вод. (ацетат) чда CH3COONa∙3H2O по запросу
Натрий фосфорнокислый 1-зам. 2-вод. чда NaH2PO4·2H2O по запросу
Натрий фосфорнокислый 1-зам. 2-вод. 99%
имп (Германия) по запросу
Натрий фосфорнокислый 2-зам. б/в ч Na2HPO4 по запросу
Натрий фосфорнокислый 2-зам. 12-вод.
чда Na2HPO4·12H2O по запросу
Натрий фосфорнокислый б/в имп Na3PO4 по запросу
Натрий фосфорнокислый пиро 10-вод. ч Na4P2O7*10H2O по запросу
Натрий фтористый чда NaF по запросу
Натрий хлористый чда NaCl по запросу
Натрий щавелевокислый хч Na2C2O4 по запросу
Натрия родизонат имп (США) C6O6Na2 по запросу
Нафталин ч C10H8
по запросу
Нафталин 2-сульфокислота ч C10H7NaO3S по запросу
Нафтиламин-а * C10H7NH2 по запросу
Нафтилэтилендиамин дигидрохлорид чда C10H7NHC2H5*HCl по запросу
Нафтол-2 чда C10H7OH по запросу
Несслера реактив чда K2[HgI4]·KOH(NaOH) по запросу
Никель (II) азотнокислый 6-вод. ч Ni(NO3)2·6H2O по запросу
Никель двухлористый 6-водный чда * по запросу
Никель углекислый основной ч * по запросу
Нингидрин 1-водный ХЧ C9H4O3*H2O по запросу
Нитрилотриуксусная к-та ч С6Н9NO9 по запросу
Нитрозо-Р-соль * NO(HO)C10H4(SO3Na)2 по запросу
Нитрометан имп СН3NO2 по запросу
О-дианизидин ч * по запросу
о-Ксилол чда C6H4(CH3)2 по запросу
Октан, (фас.1000 мл), л имп (Германия) * по запросу
Октан, (фас.250 мл), л
имп (Германия) * по запросу
Олово гранулированное ч Sn по запросу
Олово (II) сернокислое ч * по запросу
Олово (IV) хлористое ч * по запросу
Ортофосфорная кислота ч H3PO4 по запросу
о-Толуидин 99,5% (фас.100 мл), л
имп (Германия) C7H9N по запросу
о-Толуидин ч CH3C6H4NH2 по запросу
п-трет-Бутилфенол ч * по запросу
Парафин гистологический Histomix (уп.5 кг) имп * по запросу
Параформ, меш. 35-40 кг марка С (CH2O)n по запросу
Перекись водорода 37% (кан. 24 кг) фарм H2O2 по запросу
Пикриновая кислота 98% имп (Германия) C6H3N3O7 по запросу
Пиридин, л чда
C5H5N по запросу
Поливиниловый спирт ч (-C2H4O)n по запросу
Пропиловый спирт имп CH3CH2CH2OH по запросу
Прочный синий Б соль (Диазоль синий С) ч * по запросу
Прочный черный К соль ИМП C14H12N5O4*1/2ZnCl2
по запросу
Реактив (реагент) Карла Фишера (Комплект 1+2) фас. 1,5 кг чда * по запросу
Резорцин имп C6H6O2 по запросу
Ртуть окись красная чда * по запросу
Ртуть окись желтая чда * по запросу
Рубеановодородная кислота чда NH2CSCSNH2 по запросу
Салициловая кислота * C7H6O3 по запросу
Салициловый альдегид более 98% HOC6H4CHO по запросу
Сафранин О имп (Индия) C20H19N4Cl по запросу
Свинец азотнокислый (II)
хч Pb(NO3)2 по запросу
Свинец гранулированный хч * по запросу
Свинец уксуснокислый (II) 3-вод.
чда (CH3COO)2Pb·3H2O по запросу
Свинец диацетат-дигидроксид / Свинец основной ацетат ч (CH3COO)2Pb·Pb(OH)2
по запросу
Свинец диэтилдитиокарбамат * [(C2H5)2NCSS]2P по запросу
Свинец сернокислый хч * по запросу
Свинец хлористый ч * по запросу
Сера молотая техн * по запросу
Серебро азотнокислое хч AgNO3 по запросу

Серебро сернокислое (сульфат)
хч Ag2SO4 по запросу
Соль Мора (Аммоний-железо сернокислый (II)(2:1), 6-вод.)
чда (NH4)2Fe(SO4)2·6H2O
по запросу
Сорбиновая кислота сорт 1 C6H8O2 по запросу
Сплав Ренея ч * по запросу
Стеариновая кислота (стеарин Т-18)
чда CH3(CH2)16COOH по запросу
Стронций азотнокислый чда Sr(NO3)2 по запросу
Стронций сернокислый чда * по запросу
Стронций углекислый чда * по запросу
Стронций хлористый 6-вод. чда SrCL2·6H2O по запросу
Сульфаниловая кислота * NH2C6H4SO3H по запросу
Сульфосалициловая кислота 2-вод.
чда C7H6O6S·2H2O по запросу
Сурьма хлористая (III) хч SbCl3 по запросу
Тальк
Марка А Mg3Si4O10(OH)2 по запросу
Таннин ч * по запросу
Титан треххлористый ч * по запросу
Титан (IV) окись * TiO2 по запросу
Тиомочевина
чда NH2CSNH2 по запросу
Трилон Б
ч C10H14N2Na2O8·2H2O по запросу
Тринатрийфосфат техн Na3PO4·12H2O по запросу
Триоктиламин ч [CH3(CH2)7]3N по запросу
Трис(оксиметил)аминометан
ч NH2C(CH2OH)3 по запросу
Трифторуксусная кислота 25% (фас. 100 мл), л имп (Германия) * по запросу
Трихлоруксусная кислота имп Cl3CCOOH по запросу
Триэтаноламин ч N(C2H4OH)3 по запросу
Тропеолин 00, имп C18H14N3KO3S по запросу
Углерод четыреххлористый (тетрахлорметан)
хч CCl4 по запросу
Углерод четыреххлористый (тетрахлорметан) осч по запросу
Углерод четыреххлористый (тетрахлорметан) (для экстракции из водных сред)
ХЧ для ЭВС по запросу
Уротропин (Гексаметилентетрамин) марка С сорт 1 C6H12N4 по запросу
Фенантролин-о 1-вод. имп C12H8N2*H2O по запросу
Фенилфосфорной кислоты динатриевая соль, 2-вод. ч C6H5OPO(ONa)2*2H2O по запросу
Фенол чда C6H5OH по запросу
Формалин, фас. 5,2 кг
в/с * по запросу
Фосфор (V) окись ч * по запросу
Фосфорно-вольфрамовая кислота
чда H7O42PW12·nH2O по запросу

Хинолин ч C9H7N по запросу
Хлоралгидрат (2,2,2-Трихлоро-1,1-Этандиол)
имп Cl3CCH(OH)2 по запросу
Хлорная кислота 60%, 1,5 кг
ч HClO4 по запросу
Хром кислотный темно-синий * ClC6H3(OH)N=NC10H3(SP3Na)2(OH)2
по запросу
Хром треххлористый 6-вод. ч CrCl3·6H2O по запросу
Хромин техн * по запросу
Хромокалиевые квасцы чда KCr(SO4)2·12H2O по запросу
Циклогексан, л
имп (Германия) * по запросу
Циклогексанон чда * по запросу
Циклогексанол ч * по запросу
Цинк гранулированный ч Zn по запросу
Цинк оксид хч ZnO по запросу
Цинк порошок
ч * по запросу
Цинк сернокислый 7-вод. ч ZnSO4·7H2O по запросу
Цинк уксуснокислый 2-вод.
хч

Zn(CH3COO)2*2H2O

по запросу
Щавелевая кислота 2-вод.
имп H2C2O4·2H2O по запросу
Эозин Н чда C40H14Br6Na4O10 по запросу
Эритрозин чда C20H6I4Na2O5 по запросу
Этилацетат, л хч CH3COOC2H5  по запросу
Этиленгликоль, л
в/с HOCH2CH2OH по запросу
Этилендиамин, л ч NH2CH2CH2NH2 по запросу
Яблочная кислота (DL-Гидроксисукциновая кислота)
имп C4H6O5 по запросу
Янтарная кислота ч C4H6O4 по запросу
посмотреть все (298)

Другие товары и услуги компании:

Предназначена для транспортировки и хранения химических реактивов.
180 р.
Под заказ
Разработана для хранения химических веществ, в том числе летучих, фотолабильных и пахучих. С широким и узким горлом.
113 р.
А также камеры для ТСХ, трафареты, пульверизаторы, реактивы в наличии в Хабаровске!
Применение: Нагрев и перемешивание различных жидкостей (проведение химических реакций, перегонки, титрования).
23 160 р.
Предназначен для проведения физических, химических, биологических, фармацевтических процессов и измерений, требующих термостатирования образцов в диапазоне температуры от -40°С до +120°С.
167 000 р.
Информация о продавце
  • +7 (4212) 68-07-63
  • г. Хабаровск, ул. Союзная, 3к
Продажа лабораторного оборудования: весы лабораторные, мебель лабораторная, лабораторная посуда, химические реактивы (химреактивы), ГСО, вещества для хроматографии, питательные среды, стандарт-титры.
×